* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021312 |
English Synonyms: | VITAS-BB TBB021312 |
MDL Number.: | MFCD01359148 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | ClC1=CC=C(NC(=O)NNC(=O)C2=CC=CO2)C=C1 |
InChi: | InChI=1S/C12H10ClN3O3/c13-8-3-5-9(6-4-8)14-12(18)16-15-11(17)10-2-1-7-19-10/h1-7H,(H,15,17)(H2,14,16,18) |
InChiKey: | InChIKey=GSBGOCOTSUYFAP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.