* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023263 |
English Synonyms: | VITAS-BB TBB023263 |
MDL Number.: | MFCD01359276 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CC1CCC2=C(C1)SC(NC(=O)C1CC=CCC1C(O)=O)=C2C(N)=O |
InChi: | InChI=1S/C18H22N2O4S/c1-9-6-7-12-13(8-9)25-17(14(12)15(19)21)20-16(22)10-4-2-3-5-11(10)18(23)24/h2-3,9-11H,4-8H2,1H3,(H2,19,21)(H,20,22)(H,23,24) |
InChiKey: | InChIKey=MOAACRFRNIIRHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.