* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-FLUOROPYRROLO[1,2-A]QUINOXALIN-4(5H)-ONE |
CAS: | 195711-34-3 |
English Synonyms: | 9-FLUOROPYRROLO[1,2-A]QUINOXALIN-4(5H)-ONE |
MDL Number.: | MFCD01443635 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(c(c1)F)n3cccc3c(=O)[nH]2 |
InChi: | InChI=1S/C11H7FN2O/c12-7-3-1-4-8-10(7)14-6-2-5-9(14)11(15)13-8/h1-6H,(H,13,15) |
InChiKey: | InChIKey=XTXXGPBGELMXGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.