* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035471 |
| English Synonyms: | VITAS-BB TBB035471 |
| MDL Number.: | MFCD01445633 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC1=CC=C(C=C1)C1CC(=O)C2=C(C1)NC(C)=C(C2C1=CC=C(OCC2=CC=CC=C2)C=C1)C(=O)OC(C)C |
| InChi: | InChI=1S/C34H35NO5/c1-21(2)40-34(37)31-22(3)35-29-18-26(24-10-14-27(38-4)15-11-24)19-30(36)33(29)32(31)25-12-16-28(17-13-25)39-20-23-8-6-5-7-9-23/h5-17,21,26,32,35H,18-20H2,1-4H3 |
| InChiKey: | InChIKey=AFFLKLJYCFCCEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.