* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035489 |
English Synonyms: | VITAS-BB TBB035489 |
MDL Number.: | MFCD01445759 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | COCCOC(=O)C1=C(C)NC2=C(C1C1=CC3=C(OCO3)C=C1)C(=O)CC(C2)C1=CC=C(OC)C=C1 |
InChi: | InChI=1S/C28H29NO7/c1-16-25(28(31)34-11-10-32-2)26(18-6-9-23-24(14-18)36-15-35-23)27-21(29-16)12-19(13-22(27)30)17-4-7-20(33-3)8-5-17/h4-9,14,19,26,29H,10-13,15H2,1-3H3 |
InChiKey: | InChIKey=YGKLFQGNMZGNPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.