* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-BENZOYLHISTIDINE |
| CAS: | 19785-88-7 |
| English Synonyms: | N-BENZOYLHISTIDINE |
| MDL Number.: | MFCD01463732 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)C(=O)NC(Cc2cnc[nH]2)C(=O)O |
| InChi: | InChI=1S/C13H13N3O3/c17-12(9-4-2-1-3-5-9)16-11(13(18)19)6-10-7-14-8-15-10/h1-5,7-8,11H,6H2,(H,14,15)(H,16,17)(H,18,19) |
| InChiKey: | InChIKey=AUDPUFBIVWMAED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.