* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURO[2,3-C]PYRIDINE-7(6H)-ONE |
| CAS: | 84400-98-6 |
| English Synonyms: | FURO[2,3-C]PYRIDINE-7(6H)-ONE ; 6H,7H-FURO[2,3-C]PYRIDIN-7-ONE ; FURO[2,3-C]PYRIDIN-7(6H)-ONE ; 6H-FURO[2,3-C]PYRIDIN-7-ONE |
| MDL Number.: | MFCD01544382 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1c[nH]c(=O)c2c1cco2 |
| InChi: | InChI=1S/C7H5NO2/c9-7-6-5(1-3-8-7)2-4-10-6/h1-4H,(H,8,9) |
| InChiKey: | InChIKey=SHSNAKRNZGOTJL-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.