* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-1397 |
English Synonyms: | IBSCREEN-BB BB_NC-1397 |
MDL Number.: | MFCD01546661 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(=O)OCC(=O)[C@]1(CCC2[C@@]1(CCC3C2CC=C4[C@@]3(CCC(C4)O)C)C)O |
InChi: | InChI=1S/C23H34O5/c1-14(24)28-13-20(26)23(27)11-8-19-17-5-4-15-12-16(25)6-9-21(15,2)18(17)7-10-22(19,23)3/h4,16-19,25,27H,5-13H2,1-3H3/t16?,17?,18?,19?,21-,22-,23-/m0/s1 |
InChiKey: | InChIKey=PIGIYBRGSJKHQI-OAXKZHKGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.