* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,5,6,7-TETRAHYDRO-1H-INDOL-7-ONE |
CAS: | 23456-78-2 |
English Synonyms: | 4,5,6,7-TETRAHYDRO-1H-INDOL-7-ONE ; 1,4,5,6-TETRAHYDRO-7H-INDOL-7-ONE |
MDL Number.: | MFCD01548788 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c[nH]c2c1CCCC2=O |
InChi: | InChI=1S/C8H9NO/c10-7-3-1-2-6-4-5-9-8(6)7/h4-5,9H,1-3H2 |
InChiKey: | InChIKey=HBNLHFPGBPXSNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.