* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-ETHYL-8-METHYL-PYRIDO[3',2':4,5]THIENO[3,2-D]PYRIMIDIN-4-AMINE |
| CAS: | 327168-54-7 |
| English Synonyms: | 7-ETHYL-8-METHYL-PYRIDO[3',2':4,5]THIENO[3,2-D]PYRIMIDIN-4-AMINE ; PYRIDO[3',2':4,5]THIENO[3,2-D]PYRIMIDIN-4-AMINE, 7-ETHYL-8-METHYL- |
| MDL Number.: | MFCD01557785 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1c(cc2c3c(c(ncn3)N)sc2n1)C |
| InChi: | InChI=1S/C12H12N4S/c1-3-8-6(2)4-7-9-10(17-12(7)16-8)11(13)15-5-14-9/h4-5H,3H2,1-2H3,(H2,13,14,15) |
| InChiKey: | InChIKey=MJVHYIMVFRWILK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.