* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-6-IODO-2,3-DIHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLIN-5-ONE |
| English Synonyms: | 7-CHLORO-6-IODO-2,3-DIHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLIN-5-ONE |
| MDL Number.: | MFCD01566976 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2c3c(c1)c(c(c(=O)n3CCC2)I)Cl |
| InChi: | InChI=1S/C12H9ClINO/c13-9-8-5-1-3-7-4-2-6-15(11(7)8)12(16)10(9)14/h1,3,5H,2,4,6H2 |
| InChiKey: | InChIKey=XIVSDVIMNJNAHH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.