* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXACYCLOHEPTADEC-10-EN-2-ONE |
| CAS: | 28645-51-4 |
| English Synonyms: | OXACYCLOHEPTADEC-10-EN-2-ONE |
| MDL Number.: | MFCD01570845 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1CCC/C=C\CCCCCCOC(=O)CCC1 |
| InChi: | InChI=1S/C16H28O2/c17-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18-16/h1,3H,2,4-15H2/b3-1- |
| InChiKey: | InChIKey=QILMAYXCYBTEDM-IWQZZHSRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.