Molecular Structure:
CCD No.:CCD00229076
OTAVA-BB 1819606
Formula:C12 H10 F3 N O2
MolWeight:257.21
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1819606 |
| English Synonyms： | OTAVA-BB 1819606 |
| MDL Number.： | MFCD01572963 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | c1cc(cc(c1)N2C(=O)CCCC2=O)C(F)(F)F |
| InChi： | InChI=1S/C12H10F3NO2/c13-12(14,15)8-3-1-4-9(7-8)16-10(17)5-2-6-11(16)18/h1,3-4,7H,2,5-6H2 |
| InChiKey： | InChIKey=XYWVXBSTKDKBMF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
