* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL ((5,6-DIPHENYL-1,2,4-TRIAZIN-3-YL)THIO)ACETATE |
| CAS: | 41249-76-7 |
| English Synonyms: | BUTTPARK 134\40-99 ; ETHYL ((5,6-DIPHENYL-1,2,4-TRIAZIN-3-YL)THIO)ACETATE |
| MDL Number.: | MFCD01624103 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CSc1nc(c(nn1)c2ccccc2)c3ccccc3 |
| InChi: | InChI=1S/C19H17N3O2S/c1-2-24-16(23)13-25-19-20-17(14-9-5-3-6-10-14)18(21-22-19)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChiKey: | InChIKey=VCZXPVLGTNLHCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.