* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EICOSADIENOIC ACID 11,14,[1-14C] |
English Synonyms: | EICOSADIENOIC ACID 11,14,[1-14C] |
MDL Number.: | MFCD01631739 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCC/C=C/C/C=C/CCCCCCCCC[14C](=O)O |
InChi: | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6+,10-9+/i20+2 |
InChiKey: | InChIKey=XSXIVVZCUAHUJO-APRMCHGOSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.