* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-L-4-ACETAMIDOPHE |
English Synonyms: | FMOC-L-4-ACETAMIDOPHE ; FMOC-L-PHE(4-NHAC) |
MDL Number.: | MFCD01632242 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(=O)Nc1ccc(cc1)C[C@@H](C(=O)O)NC(=O)OCC2c3ccccc3-c4c2cccc4 |
InChi: | InChI=1S/C26H24N2O5/c1-16(29)27-18-12-10-17(11-13-18)14-24(25(30)31)28-26(32)33-15-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-13,23-24H,14-15H2,1H3,(H,27,29)(H,28,32)(H,30,31)/t24-/m0/s1 |
InChiKey: | InChIKey=OJDKWDQVBLTUAW-DEOSSOPVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.