Molecular Structure:
CCD No.:CCD00234843
OTAVA-BB 1792479
Formula:C15 H21 N
MolWeight:215.338
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1792479 |
| English Synonyms： | OTAVA-BB 1792479 |
| MDL Number.： | MFCD01651685 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | c1ccc2c(c1)CCN(C2)CC3CCCC3 |
| InChi： | InChI=1S/C15H21N/c1-2-6-13(5-1)11-16-10-9-14-7-3-4-8-15(14)12-16/h3-4,7-8,13H,1-2,5-6,9-12H2 |
| InChiKey： | InChIKey=DMJVLJYUBULWHN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
