* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ELAIOMYCIN |
CAS: | 23315-05-1 |
English Synonyms: | ELAIOMYCIN |
MDL Number.: | MFCD01656105 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCCCC/C=C\[N+](=N/[C@@H](COC)[C@H](C)O)\[O-] |
InChi: | InChI=1S/C13H26N2O3/c1-4-5-6-7-8-9-10-15(17)14-13(11-18-3)12(2)16/h9-10,12-13,16H,4-8,11H2,1-3H3/b10-9-,15-14+/t12-,13-/m0/s1 |
InChiKey: | InChIKey=BCPWSYQGYBTINM-DDGRALPLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.