* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GYKI 11679 |
| CAS: | 69579-13-1 |
| English Synonyms: | GYKI 11679 |
| MDL Number.: | MFCD01656131 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | C/C(=N\Nc1ccc(nn1)N2CCOCC2)/CC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C16H25N5O3/c1-12(11-15(22)24-16(2,3)4)17-18-13-5-6-14(20-19-13)21-7-9-23-10-8-21/h5-6H,7-11H2,1-4H3,(H,18,19)/b17-12+ |
| InChiKey: | InChIKey=YCVVCSICMNKDBE-SFQUDFHCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.