* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHAMIDINDOLE |
| CAS: | 72593-08-9 |
| English Synonyms: | ETHAMIDINDOLE |
| MDL Number.: | MFCD01657025 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)c3c([nH]2)CN4CCN(CC4C3)CCNC(=O)c5ccc(cc5)C(=O)N |
| InChi: | InChI=1S/C24H27N5O2/c25-23(30)16-5-7-17(8-6-16)24(31)26-9-10-28-11-12-29-15-22-20(13-18(29)14-28)19-3-1-2-4-21(19)27-22/h1-8,18,27H,9-15H2,(H2,25,30)(H,26,31) |
| InChiKey: | InChIKey=MIFGBHJILJHNJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.