* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KELFIPRIM |
| CAS: | 50933-06-7 |
| English Synonyms: | KELFIPRIM |
| MDL Number.: | MFCD01657690 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COc1cc(cc(c1OC)OC)Cc2cnc(nc2N)N.COc1c(nccn1)NS(=O)(=O)c2ccc(cc2)N |
| InChi: | InChI=1S/C14H18N4O3.C11H12N4O3S/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15;1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h5-7H,4H2,1-3H3,(H4,15,16,17,18);2-7H,12H2,1H3,(H,13,15) |
| InChiKey: | InChIKey=DMIUGJLERMOBNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.