* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WY5244 |
CAS: | 13822-05-4 |
English Synonyms: | WY5244 |
MDL Number.: | MFCD01659417 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)CNCCNC2c3ccc(cc3)Cl.Cl.Cl |
InChi: | InChI=1S/C16H17ClN2.2ClH/c17-14-7-5-12(6-8-14)16-15-4-2-1-3-13(15)11-18-9-10-19-16;;/h1-8,16,18-19H,9-11H2;2*1H |
InChiKey: | InChIKey=YSEKTJDZLUWDBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.