* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUILOFLEX |
CAS: | 2307-81-5 |
English Synonyms: | QUILOFLEX |
MDL Number.: | MFCD01659516 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COCCCNCC1COc2ccccc2O1.Cl |
InChi: | InChI=1S/C13H19NO3.ClH/c1-15-8-4-7-14-9-11-10-16-12-5-2-3-6-13(12)17-11;/h2-3,5-6,11,14H,4,7-10H2,1H3;1H |
InChiKey: | InChIKey=ZFKJIMJKFOYFAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.