* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 37174059 |
| English Synonyms: | EMOLECULES 37174059 |
| MDL Number.: | MFCD01659935 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1Cl)CC(O2)CN.Cl |
| InChi: | InChI=1S/C9H10ClNO.ClH/c10-7-1-2-9-6(3-7)4-8(5-11)12-9;/h1-3,8H,4-5,11H2;1H |
| InChiKey: | InChIKey=DNMZYYCWJWLGDJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.