* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 3800 |
CAS: | 100811-80-1 |
English Synonyms: | WIN 3800 |
MDL Number.: | MFCD01660205 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCCOc1cc(ccc1C(=O)SCCN(CC)CC)N.Cl |
InChi: | InChI=1S/C17H28N2O2S.ClH/c1-4-7-11-21-16-13-14(18)8-9-15(16)17(20)22-12-10-19(5-2)6-3;/h8-9,13H,4-7,10-12,18H2,1-3H3;1H |
InChiKey: | InChIKey=MOYXUPSBGLYMCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.