* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WIN 3643 |
| CAS: | 100347-79-3 |
| English Synonyms: | WIN 3643 |
| MDL Number.: | MFCD01660266 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCN(CC)CCOC(=O)c1ccc(cc1OCc2ccccc2)N.Cl |
| InChi: | InChI=1S/C20H26N2O3.ClH/c1-3-22(4-2)12-13-24-20(23)18-11-10-17(21)14-19(18)25-15-16-8-6-5-7-9-16;/h5-11,14H,3-4,12-13,15,21H2,1-2H3;1H |
| InChiKey: | InChIKey=WDUFCVULMIJMBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.