Molecular Structure:
CCD No.:CCD00235872
WIN 3503
CAS No.:
100347-84-0
Formula:C22 H28 N2 O3 . H3 O4 P
MolWeight:466.468
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | WIN 3503 |
| CAS： | 100347-84-0 |
| English Synonyms： | WIN 3503 |
| MDL Number.： | MFCD01660269 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)COc2cc(ccc2C(=O)OCCCN3CCCCC3)N.OP(=O)(O)O |
| InChi： | InChI=1S/C22H28N2O3.H3O4P/c23-19-10-11-20(21(16-19)27-17-18-8-3-1-4-9-18)22(25)26-15-7-14-24-12-5-2-6-13-24;1-5(2,3)4/h1,3-4,8-11,16H,2,5-7,12-15,17,23H2;(H3,1,2,3,4) |
| InChiKey： | InChIKey=ZEFJKTDVBATXPM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
