* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | S 812 |
| CAS: | 104068-16-8 |
| English Synonyms: | S 812 |
| MDL Number.: | MFCD01660279 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCCOc1cc(ccc1C(=O)OCCN(C)C)N |
| InChi: | InChI=1S/C15H24N2O3/c1-4-5-9-19-14-11-12(16)6-7-13(14)15(18)20-10-8-17(2)3/h6-7,11H,4-5,8-10,16H2,1-3H3 |
| InChiKey: | InChIKey=CVNZUXHXTUSZSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.