Molecular Structure:
CCD No.:CCD00235877
WIN 3502
CAS No.:
100811-78-7
Formula:C19 H30 N2 O3 . H3 O4 P
MolWeight:432.451
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | WIN 3502 |
| CAS： | 100811-78-7 |
| English Synonyms： | WIN 3502 |
| MDL Number.： | MFCD01660283 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCCCOc1cc(ccc1C(=O)OCCCN2CCCCC2)N.OP(=O)(O)O |
| InChi： | InChI=1S/C19H30N2O3.H3O4P/c1-2-3-13-23-18-15-16(20)8-9-17(18)19(22)24-14-7-12-21-10-5-4-6-11-21;1-5(2,3)4/h8-9,15H,2-7,10-14,20H2,1H3;(H3,1,2,3,4) |
| InChiKey： | InChIKey=JERWAZWOGZRFTL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
