* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WIN 3443 |
| CAS: | 100811-88-9 |
| English Synonyms: | WIN 3443 |
| MDL Number.: | MFCD01660360 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOc1cc(ccc1C(=O)OCCCN2CCCCC2)N.Cl.Cl |
| InChi: | InChI=1S/C17H26N2O3.2ClH/c1-2-21-16-13-14(18)7-8-15(16)17(20)22-12-6-11-19-9-4-3-5-10-19;;/h7-8,13H,2-6,9-12,18H2,1H3;2*1H |
| InChiKey: | InChIKey=XFSSXIUFZOFTNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.