* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 3698 |
CAS: | 100811-87-8 |
English Synonyms: | WIN 3698 |
MDL Number.: | MFCD01660436 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCN(CC)CCCOC(=O)c1ccc(cc1OCC)N.Cl.Cl |
InChi: | InChI=1S/C16H26N2O3.2ClH/c1-4-18(5-2)10-7-11-21-16(19)14-9-8-13(17)12-15(14)20-6-3;;/h8-9,12H,4-7,10-11,17H2,1-3H3;2*1H |
InChiKey: | InChIKey=ISBJHVKLCZWDPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.