* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-EPOXY-7,8,9,10-TETRAHYDROBENZO(A)PYRENE |
CAS: | 36504-68-4 |
English Synonyms: | 9,10-EPOXY-7,8,9,10-TETRAHYDROBENZO(A)PYRENE |
MDL Number.: | MFCD01662957 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc2ccc3cc4c(c5c3c2c(c1)cc5)C6C(O6)CC4 |
InChi: | InChI=1S/C20H14O/c1-2-11-4-5-13-10-14-7-9-16-20(21-16)19(14)15-8-6-12(3-1)17(11)18(13)15/h1-6,8,10,16,20H,7,9H2 |
InChiKey: | InChIKey=DUHHIDHETBMUJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.