* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | COCHLIODINOL |
| CAS: | 11051-88-0 |
| English Synonyms: | COCHLIODINOL |
| MDL Number.: | MFCD01663132 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CC(=CCc1ccc2c(c1)c(c[nH]2)C3=C(C(=O)C(=C(C3=O)O)c4c[nH]c5c4cc(cc5)CC=C(C)C)O)C |
| InChi: | InChI=1S/C32H30N2O4/c1-17(2)5-7-19-9-11-25-21(13-19)23(15-33-25)27-29(35)31(37)28(32(38)30(27)36)24-16-34-26-12-10-20(14-22(24)26)8-6-18(3)4/h5-6,9-16,33-35,38H,7-8H2,1-4H3 |
| InChiKey: | InChIKey=ZXRULNXZJSCTQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.