* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 1,2,4-BENZOTRIAZINE-3-ACETATE |
| CAS: | 77475-32-2 |
| English Synonyms: | ETHYL 1,2,4-BENZOTRIAZINE-3-ACETATE |
| MDL Number.: | MFCD01663721 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)Cc1nc2ccccc2nn1 |
| InChi: | InChI=1S/C11H11N3O2/c1-2-16-11(15)7-10-12-8-5-3-4-6-9(8)13-14-10/h3-6H,2,7H2,1H3 |
| InChiKey: | InChIKey=MWAVYFFYPQEWLY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.