* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-7-(2-METHYLENE-1-OXOBUTYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE |
| CAS: | 116337-81-6 |
| English Synonyms: | 4-METHYL-7-(2-METHYLENE-1-OXOBUTYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE |
| MDL Number.: | MFCD01664120 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCC(=C)C(=O)c1ccc2c(c1)OCC(=O)N2C |
| InChi: | InChI=1S/C14H15NO3/c1-4-9(2)14(17)10-5-6-11-12(7-10)18-8-13(16)15(11)3/h5-7H,2,4,8H2,1,3H3 |
| InChiKey: | InChIKey=KALQVNGZTBLJJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.