* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | STEPORPHINE |
| CAS: | 24191-98-8 |
| English Synonyms: | STEPORPHINE |
| MDL Number.: | MFCD01664542 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CN1C[C@H](c2cc3c(c-4c2[C@H]1Cc5c4cccc5)OCO3)O |
| InChi: | InChI=1S/C18H17NO3/c1-19-8-14(20)12-7-15-18(22-9-21-15)17-11-5-3-2-4-10(11)6-13(19)16(12)17/h2-5,7,13-14,20H,6,8-9H2,1H3/t13-,14-/m1/s1 |
| InChiKey: | InChIKey=RCKNRLRYLSSRKX-ZIAGYGMSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.