* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SQ 28,300 |
| CAS: | 89948-18-5 |
| English Synonyms: | SQ 28,300 |
| MDL Number.: | MFCD01669985 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCS[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)SCCF |
| InChi: | InChI=1S/C23H32F2O2S2/c1-4-28-22(29-12-11-24)10-8-17-18-6-5-15-13-16(26)7-9-20(15,2)23(18,25)19(27)14-21(17,22)3/h7,9,13,17-19,27H,4-6,8,10-12,14H2,1-3H3/t17-,18-,19-,20-,21-,22+,23-/m0/s1 |
| InChiKey: | InChIKey=JTJCHHROIYDRDK-RSRKLVJMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.