* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | V 377 |
CAS: | 77966-84-8 |
English Synonyms: | V 377 |
MDL Number.: | MFCD01673402 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1NC(=O)CN(C(C)C)C(C)C)C.Cl |
InChi: | InChI=1S/C16H26N2O.ClH/c1-11(2)18(12(3)4)10-15(19)17-16-13(5)8-7-9-14(16)6;/h7-9,11-12H,10H2,1-6H3,(H,17,19);1H |
InChiKey: | InChIKey=OJTPHJHZGWBMET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.