* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-AMINO-1-METHYL-ACRIDINE |
CAS: | 23045-11-6 |
English Synonyms: | 9-AMINO-1-METHYL-ACRIDINE |
MDL Number.: | MFCD01673558 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cccc2c1c(c3ccccc3n2)N |
InChi: | InChI=1S/C14H12N2/c1-9-5-4-8-12-13(9)14(15)10-6-2-3-7-11(10)16-12/h2-8H,1H3,(H2,15,16) |
InChiKey: | InChIKey=QDFZZUZHYOGLPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.