* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-10-METHYLACRIDINE |
CAS: | 46492-10-8 |
English Synonyms: | 9-CHLORO-10-METHYLACRIDINE |
MDL Number.: | MFCD01673824 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[n+]1c2ccccc2c(c3c1cccc3)Cl |
InChi: | InChI=1S/C14H11ClN/c1-16-12-8-4-2-6-10(12)14(15)11-7-3-5-9-13(11)16/h2-9H,1H3/q+1 |
InChiKey: | InChIKey=SCDPBLWNXODKAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.