* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERSICOLORIN A |
| CAS: | 6807-96-1 |
| English Synonyms: | VERSICOLORIN A |
| MDL Number.: | MFCD01675149 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1c(cc(c2c1C(=O)c3cc4c(c(c3C2=O)O)[C@@H]5C=CO[C@@H]5O4)O)O |
| InChi: | InChI=1S/C18H10O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h1-5,7,18-20,23H/t7-,18+/m0/s1 |
| InChiKey: | InChIKey=SJNDYXPJRUTLNW-ULCDLSAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.