* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EDERPIN |
| CAS: | 25635-68-1 |
| English Synonyms: | EDERPIN |
| MDL Number.: | MFCD01676894 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | COc1cnc(nc1)NC(=O)NP(=O)(N2CC2)N3CC3 |
| InChi: | InChI=1S/C10H15N6O3P/c1-19-8-6-11-9(12-7-8)13-10(17)14-20(18,15-2-3-15)16-4-5-16/h6-7H,2-5H2,1H3,(H2,11,12,13,14,17,18) |
| InChiKey: | InChIKey=DQRQBRDDSALHQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.