* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FENCHLORAZOLE |
| CAS: | 103112-36-3 |
| English Synonyms: | FENCHLORAZOLE |
| MDL Number.: | MFCD01678696 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc(c(cc1Cl)Cl)n2c(nc(n2)C(=O)O)C(Cl)(Cl)Cl |
| InChi: | InChI=1S/C10H4Cl5N3O2/c11-4-1-2-6(5(12)3-4)18-9(10(13,14)15)16-7(17-18)8(19)20/h1-3H,(H,19,20) |
| InChiKey: | InChIKey=HKELWJONQIFBPO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.