* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(OCTYLOXY)-1,3,5-TRIAZINE-2,4-DIAMINE |
| CAS: | 19619-58-0 |
| English Synonyms: | 6-(OCTYLOXY)-1,3,5-TRIAZINE-2,4-DIAMINE |
| MDL Number.: | MFCD01678994 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCCCCCCOc1nc(nc(n1)N)N |
| InChi: | InChI=1S/C11H21N5O/c1-2-3-4-5-6-7-8-17-11-15-9(12)14-10(13)16-11/h2-8H2,1H3,(H4,12,13,14,15,16) |
| InChiKey: | InChIKey=IRHDBABFPRZYDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.