* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SPIRILENE |
| CAS: | 357-66-4 |
| English Synonyms: | SPIRILENE |
| MDL Number.: | MFCD01679402 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C/C(=C\CCN1CCC2(CC1)C(=O)NCN2c3ccccc3)/c4ccc(cc4)F |
| InChi: | InChI=1S/C24H28FN3O/c1-19(20-9-11-21(25)12-10-20)6-5-15-27-16-13-24(14-17-27)23(29)26-18-28(24)22-7-3-2-4-8-22/h2-4,6-12H,5,13-18H2,1H3,(H,26,29)/b19-6+ |
| InChiKey: | InChIKey=YBPJJOQQWQASHM-KPSZGOFPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.