* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERSICOLIN |
| CAS: | 4389-44-0 |
| English Synonyms: | VERSICOLIN ; 3-METHYLBENZENE-1,2,4-TRIOL |
| MDL Number.: | MFCD01679613 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | Cc1c(ccc(c1O)O)O |
| InChi: | InChI=1S/C7H8O3/c1-4-5(8)2-3-6(9)7(4)10/h2-3,8-10H,1H3 |
| InChiKey: | InChIKey=WPFZLGOGWVNEID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.