* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(4-METHYLPHENYL)OXIRANE |
| CAS: | 13107-39-6 |
| English Synonyms: | OXIRANE, 2-(4-METHYLPHENYL)- ; 2-(4-METHYLPHENYL)OXIRANE |
| MDL Number.: | MFCD01679658 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cc1)C2CO2 |
| InChi: | InChI=1S/C9H10O/c1-7-2-4-8(5-3-7)9-6-10-9/h2-5,9H,6H2,1H3 |
| InChiKey: | InChIKey=QAWJAMQTRGCJMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.