* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GENTAMICIN X2 |
| CAS: | 36889-17-5 |
| English Synonyms: | GENTAMICIN X2 |
| MDL Number.: | MFCD01683539 |
| H bond acceptor: | 14 |
| H bond donor: | 10 |
| Smile: | C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)N)N)N)O |
| InChi: | InChI=1S/C19H38N4O10/c1-19(29)5-30-18(13(28)16(19)23-2)33-15-7(21)3-6(20)14(12(15)27)32-17-9(22)11(26)10(25)8(4-24)31-17/h6-18,23-29H,3-5,20-22H2,1-2H3/t6-,7+,8+,9+,10+,11+,12-,13+,14+,15-,16+,17+,18+,19-/m0/s1 |
| InChiKey: | InChIKey=HFLKNINDVFJPQT-ZFAMMYHGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.