* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XYLOTUBERCIDIN |
CAS: | 64526-29-0 |
English Synonyms: | XYLOTUBERCIDIN |
MDL Number.: | MFCD01686895 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cn(c2c1c(ncn2)N)[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)O |
InChi: | InChI=1S/C11H14N4O4/c12-9-5-1-2-15(10(5)14-4-13-9)11-8(18)7(17)6(3-16)19-11/h1-2,4,6-8,11,16-18H,3H2,(H2,12,13,14)/t6-,7+,8-,11-/m1/s1 |
InChiKey: | InChIKey=HDZZVAMISRMYHH-FBSDJGSXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.