* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FUMITREMORGIN B |
CAS: | 12626-17-4 |
English Synonyms: | FUMITREMORGIN B |
MDL Number.: | MFCD01686952 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CC(=CCn1c2cc(ccc2c3c1[C@@H](N4C(=O)[C@@H]5CCCN5C(=O)[C@@]4([C@H]3O)O)C=C(C)C)OC)C |
InChi: | InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1 |
InChiKey: | InChIKey=WEIYXEFMCIRZHC-MWGWWEMPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.